4,5-Diamino-9H-fluoren-9-one structure
|
Common Name | 4,5-Diamino-9H-fluoren-9-one | ||
|---|---|---|---|---|
| CAS Number | 54147-68-1 | Molecular Weight | 210.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-Diaminofluorenon |
|---|
| Molecular Formula | C13H10N2O |
|---|---|
| Molecular Weight | 210.23100 |
| Exact Mass | 210.07900 |
| PSA | 69.11000 |
| LogP | 3.22480 |
| InChIKey | QMRQBHRUQRRJCX-UHFFFAOYSA-N |
| SMILES | Nc1cccc2c1-c1c(N)cccc1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |