2-Pyridineacrylonitrile,a-(4,5-dimethoxy-2-nitrophenyl)-(6CI,8CI) structure
|
Common Name | 2-Pyridineacrylonitrile,a-(4,5-dimethoxy-2-nitrophenyl)-(6CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 5415-51-0 | Molecular Weight | 311.29200 | |
| Density | 1.302g/cm3 | Boiling Point | 519ºC at 760 mmHg | |
| Molecular Formula | C16H13N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.7ºC | |
| Name | 2-(4,5-dimethoxy-2-nitrophenyl)-3-pyridin-2-ylprop-2-enenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.302g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760 mmHg |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.29200 |
| Flash Point | 267.7ºC |
| Exact Mass | 311.09100 |
| PSA | 100.96000 |
| LogP | 3.59438 |
| Index of Refraction | 1.628 |
| InChIKey | NPNGKQVZNIPDKT-YRNVUSSQSA-N |
| SMILES | COc1cc(C(C#N)=Cc2ccccn2)c([N+](=O)[O-])cc1OC |
|
~%
2-Pyridineacryl... CAS#:5415-51-0 |
| Literature: Walker Journal of the American Chemical Society, 1956 , vol. 78, p. 3698,3699 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (3R,5R,8S,9S,10S,13S,14S,17R)-17-[(1R)-1,2-dihydroxyethyl]-3,17-dihydr oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopen ta[a]phenanthren-11-one |
| B-Cortolone |