2H-Pyran-2,4(3H)-dione,3-[3-(3,4-dimethoxyphenyl)propyl]dihydro-6-methyl- structure
|
Common Name | 2H-Pyran-2,4(3H)-dione,3-[3-(3,4-dimethoxyphenyl)propyl]dihydro-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 5415-52-1 | Molecular Weight | 306.35400 | |
| Density | 1.121g/cm3 | Boiling Point | 480.2ºC at 760mmHg | |
| Molecular Formula | C17H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.9ºC | |
| Name | 3-(3-(3,4-dimethoxyphenyl)propyl)-6-methyldihydro-2H-pyran-2,4(3H)-dione |
|---|
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 480.2ºC at 760mmHg |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.35400 |
| Flash Point | 263.9ºC |
| Exact Mass | 306.14700 |
| PSA | 61.83000 |
| LogP | 2.54720 |
| Index of Refraction | 1.507 |
| InChIKey | QTWZJCZWBIOKLG-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCCC2C(=O)CC(C)OC2=O)cc1OC |
| HS Code | 2932999099 |
|---|
|
~%
2H-Pyran-2,4(3H... CAS#:5415-52-1 |
| Literature: Walker Journal of the American Chemical Society, 1956 , vol. 78, p. 3201,3204 |
|
~%
2H-Pyran-2,4(3H... CAS#:5415-52-1 |
| Literature: Walker Journal of the American Chemical Society, 1956 , vol. 78, p. 3201,3204 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |