N-[2-[methyl(2-phenylethyl)amino]propyl]-N-pyridin-2-ylpropanamide structure
|
Common Name | N-[2-[methyl(2-phenylethyl)amino]propyl]-N-pyridin-2-ylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 54153-11-6 | Molecular Weight | 325.44800 | |
| Density | 1.078g/cm3 | Boiling Point | 465.4ºC at 760 mmHg | |
| Molecular Formula | C20H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.2ºC | |
| Name | N-[2-[methyl(2-phenylethyl)amino]propyl]-N-pyridin-2-ylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 465.4ºC at 760 mmHg |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.44800 |
| Flash Point | 235.2ºC |
| Exact Mass | 325.21500 |
| PSA | 36.44000 |
| LogP | 3.38760 |
| Index of Refraction | 1.572 |
| InChIKey | JURYTEGZRXCVSY-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(CC(C)N(C)CCc1ccccc1)c1ccccn1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-(2-(Methyl(2-phenylethyl)amino)propyl)-N-2-pyridinylpropanamide |
| Propanamide,N-(2-(methyl(2-phenylethyl)amino)propyl)-N-2-pyridinyl |
| N-[2-[methyl(phenethyl)amino]propyl]-N-pyridin-2-ylpropanamide |
| 2-<Propionyl-2-(methyl-phenethyl-amino)-propyl-amino>-pyridin |
| N-[2-(methyl-phenethyl-amino)-propyl]-N-pyridin-2-yl-propionamide |
| N-(2-(METHYL(2-PHENYLETHYL)AMINO)PROPYL)-N-PYRIDIN-2-YLPROPANAMIDE |