2,4,6-trimethyl-1,3,5,2,4,6-trithiatriazinane 1,1,3,3,5,5-hexaoxide structure
|
Common Name | 2,4,6-trimethyl-1,3,5,2,4,6-trithiatriazinane 1,1,3,3,5,5-hexaoxide | ||
|---|---|---|---|---|
| CAS Number | 54153-68-3 | Molecular Weight | 279.31500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C3H9N3O6S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-trimethyl-1,3,5,2,4,6-trithiatriazinane 1,1,3,3,5,5-hexaoxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C3H9N3O6S3 |
|---|---|
| Molecular Weight | 279.31500 |
| Exact Mass | 278.96500 |
| PSA | 137.28000 |
| LogP | 0.58590 |
| InChIKey | WQNZCZAGKQMPMM-UHFFFAOYSA-N |
| SMILES | CN1S(=O)(=O)N(C)S(=O)(=O)N(C)S1(=O)=O |
|
~58%
2,4,6-trimethyl... CAS#:54153-68-3 |
| Literature: Faleschini, Gottfried; Nachbaur, Edgar; Belaj, Ferdinand Phosphorus, Sulfur and Silicon and the Related Elements, 1992 , vol. 65, # 1.4 p. 147 - 150 |
|
~%
2,4,6-trimethyl... CAS#:54153-68-3 |
| Literature: Hantzsch; Holl Chemische Berichte, 1901 , vol. 34, p. 3445 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N.N'.N''-Trimethyl-trisulfimid |
| trimethyl-cyclotriazathiane-1,1,3,3,5,5-hexaoxide |
| 1,3,5,2,4,6-Trithiatriazine,2,4,6-trimethyl-,1,1,3,3,5,5-hexaoxide |
| Trisulfimid-tris-N-methylaether |
| Trimethyl-cyclotriazathian-1,1,3,3,5,5-hexaoxid |