[1,1'-Biphenyl]-4,4'-diamine,N4,N4'-bis(2,7-dinitro-9H-fluoren-9-ylidene)- structure
|
Common Name | [1,1'-Biphenyl]-4,4'-diamine,N4,N4'-bis(2,7-dinitro-9H-fluoren-9-ylidene)- | ||
|---|---|---|---|---|
| CAS Number | 5416-81-9 | Molecular Weight | 688.60100 | |
| Density | 1.54g/cm3 | Boiling Point | 888.2ºC at 760 mmHg | |
| Molecular Formula | C38H20N6O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 491ºC | |
| Name | N-[4-[4-[(2,7-dinitrofluoren-9-ylidene)amino]phenyl]phenyl]-2,7-dinitrofluoren-9-imine |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 888.2ºC at 760 mmHg |
| Molecular Formula | C38H20N6O8 |
| Molecular Weight | 688.60100 |
| Flash Point | 491ºC |
| Exact Mass | 688.13400 |
| PSA | 208.00000 |
| LogP | 11.37820 |
| Index of Refraction | 1.775 |
| InChIKey | WUEBQADJZRHHKF-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=Nc1ccc(-c3ccc(N=C4c5cc([N+](=O)[O-])ccc5-c5ccc([N+](=O)[O-])cc54)cc3)cc1)c1cc([N+](=O)[O-])ccc1-2 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |