ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate
Modify Date: 2025-09-20 14:44:20
![ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate Structure](https://image.chemsrc.com/caspic/109/54166-79-9.png)
ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate structure
|
Common Name | ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate | ||
|---|---|---|---|---|
| CAS Number | 54166-79-9 | Molecular Weight | 306.19500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9F3N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[2-nitro-4-(trifluoromethyl)anilino]-2-oxoacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9F3N2O5 |
|---|---|
| Molecular Weight | 306.19500 |
| Exact Mass | 306.04600 |
| PSA | 101.22000 |
| LogP | 2.71140 |
| InChIKey | HPWJLXSOUJRZLN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)Nc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
|
~%
ethyl 2-[2-nitr... CAS#:54166-79-9 |
| Literature: Sellstedt; Guinosso; Begany; Bell; Rosenthale Journal of Medicinal Chemistry, 1975 , vol. 18, # 9 p. 926 - 933 |
|
~%
ethyl 2-[2-nitr... CAS#:54166-79-9 |
| Literature: Lubisch; Behl; Hofmann Bioorganic and Medicinal Chemistry Letters, 1996 , vol. 6, # 23 p. 2887 - 2892 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethyl N-(2-nitro-4-trifluoromethylphenyl)oxamate |
| 2'-Nitro-4'-(trifluormethyl)-oxanilsaeure-ethylester |
| Acetic acid,[[2-nitro-4-(trifluoromethyl)phenyl]amino]oxo-,ethyl ester |
| 2'-Nitro-4'-(trifluoromethyl)oxanilic acid ethyl ester |