Ethanol,2-[[3-[(7-chloro-4-quinolinyl)amino]propyl]amino]- structure
|
Common Name | Ethanol,2-[[3-[(7-chloro-4-quinolinyl)amino]propyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 5418-53-1 | Molecular Weight | 279.76500 | |
| Density | 1.268g/cm3 | Boiling Point | 505.7ºC at 760mmHg | |
| Molecular Formula | C14H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.6ºC | |
| Name | 2-[3-[(7-chloroquinolin-4-yl)amino]propylamino]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.268g/cm3 |
|---|---|
| Boiling Point | 505.7ºC at 760mmHg |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.76500 |
| Flash Point | 259.6ºC |
| Exact Mass | 279.11400 |
| PSA | 57.18000 |
| LogP | 2.73600 |
| Index of Refraction | 1.649 |
| InChIKey | MNUUKEZBBCZHQH-UHFFFAOYSA-N |
| SMILES | OCCNCCCNc1ccnc2cc(Cl)ccc12 |
|
~%
Ethanol,2-[[3-[... CAS#:5418-53-1 |
| Literature: Surrey; Hammer Journal of the American Chemical Society, 1950 , vol. 72, p. 1814 |
|
~%
Ethanol,2-[[3-[... CAS#:5418-53-1 |
| Literature: Surrey; Hammer Journal of the American Chemical Society, 1950 , vol. 72, p. 1814 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-({3-[(7-chloroquinolin-4-yl)amino]propyl}amino)ethanol |
| 2-[3-(7-Chlor-[4]chinolylamino)-propylamino]-aethanol |
| 2-[3-(7-chloro-[4]quinolylamino)-propylamino]-ethanol |