1-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-2H-quinoline structure
|
Common Name | 1-methyl-2-[(E)-2-(3-nitrophenyl)ethenyl]-2H-quinoline | ||
|---|---|---|---|---|
| CAS Number | 5418-78-0 | Molecular Weight | 418.22800 | |
| Density | 1.267g/cm3 | Boiling Point | 459.5ºC at 760 mmHg | |
| Molecular Formula | C18H15IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.7ºC | |
| Name | 1-methyl-2-[2-(3-nitrophenyl)ethenyl]quinolin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 459.5ºC at 760 mmHg |
| Molecular Formula | C18H15IN2O2 |
| Molecular Weight | 418.22800 |
| Flash Point | 231.7ºC |
| Exact Mass | 418.01800 |
| PSA | 49.70000 |
| LogP | 1.27010 |
| Index of Refraction | 1.71 |
| InChIKey | HFJZDAXMGQDELZ-LBEJWNQZSA-M |
| SMILES | C[n+]1c(C=Cc2cccc([N+](=O)[O-])c2)ccc2ccccc21.[I-] |
|
~%
1-methyl-2-[(E)... CAS#:5418-78-0 |
| Literature: Graef et al. Journal of Organic Chemistry, 1946 , vol. 11, p. 257,263 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4-(1-methyl-5-nitro-1H-imidazol-2-ylmethoxy)-benzonitrile |
| 1-Methyl-2-(3-nitro-trans-styryl)-chinolinium,Jodid |
| 1-methyl-2-(3-nitro-trans-styryl)-quinolinium,iodide |
| Benzonitrile,2-methyl-4-[(1-methyl-5-nitro-1H-imidazol-2-yl)methoxy] |
| 1-methyl-2-(3-methyl-4-cyanophenoxymethyl)-5-nitro-imidazole |