N-[4-(2,4-dichlorophenoxy)but-2-ynyl]-N-methyl-aniline structure
|
Common Name | N-[4-(2,4-dichlorophenoxy)but-2-ynyl]-N-methyl-aniline | ||
|---|---|---|---|---|
| CAS Number | 54185-99-8 | Molecular Weight | 320.21300 | |
| Density | 1.267g/cm3 | Boiling Point | 457.3ºC at 760 mmHg | |
| Molecular Formula | C17H15Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.4ºC | |
| Name | N-[4-(2,4-dichlorophenoxy)but-2-ynyl]-N-methylaniline |
|---|
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 457.3ºC at 760 mmHg |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.21300 |
| Flash Point | 230.4ºC |
| Exact Mass | 319.05300 |
| PSA | 12.47000 |
| LogP | 4.51200 |
| Index of Refraction | 1.618 |
| InChIKey | HBKDZXSCGFTQSJ-UHFFFAOYSA-N |
| SMILES | CN(CC#CCOc1ccc(Cl)cc1Cl)c1ccccc1 |
|
~%
N-[4-(2,4-dichl... CAS#:54185-99-8 |
| Literature: Hillard,J. et al. Journal of Heterocyclic Chemistry, 1974 , vol. 11, p. 369 - 375 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |