Phenylalanine,N-(iodoacetyl)- (9CI) structure
|
Common Name | Phenylalanine,N-(iodoacetyl)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 5419-43-2 | Molecular Weight | 333.12200 | |
| Density | 1.739g/cm3 | Boiling Point | 510.9ºC at 760mmHg | |
| Molecular Formula | C11H12INO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.8ºC | |
| Name | 2-[(2-iodoacetyl)amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.739g/cm3 |
|---|---|
| Boiling Point | 510.9ºC at 760mmHg |
| Molecular Formula | C11H12INO3 |
| Molecular Weight | 333.12200 |
| Flash Point | 262.8ºC |
| Exact Mass | 332.98600 |
| PSA | 66.40000 |
| LogP | 1.62440 |
| Index of Refraction | 1.626 |
| InChIKey | XTMUZQRZFDMMCK-UHFFFAOYSA-N |
| SMILES | O=C(CI)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
Phenylalanine,N... CAS#:5419-43-2 |
| Literature: Sheehan; Duggins Journal of the American Chemical Society, 1950 , vol. 72, p. 2475 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Jodacetyl-phenylalanin |
| 2-[(2-IODOACETYL)AMINO]-3-PHENYL-PROPANOIC ACID |
| n-(iodoacetyl)phenylalanine |