2,4-dichloro-6-[(5-chloro-2-hydroxy-phenyl)methyl]phenol structure
|
Common Name | 2,4-dichloro-6-[(5-chloro-2-hydroxy-phenyl)methyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 5419-53-4 | Molecular Weight | 303.56800 | |
| Density | 1.506g/cm3 | Boiling Point | 424.4ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
| Name | 2,4-dichloro-6-[(5-chloro-2-hydroxyphenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.506g/cm3 |
|---|---|
| Boiling Point | 424.4ºC at 760 mmHg |
| Molecular Formula | C13H9Cl3O2 |
| Molecular Weight | 303.56800 |
| Flash Point | 210.5ºC |
| Exact Mass | 301.96700 |
| PSA | 40.46000 |
| LogP | 4.64880 |
| Index of Refraction | 1.655 |
| InChIKey | IYRGELGEXONOMJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc(Cl)cc1Cc1cc(Cl)cc(Cl)c1O |
|
~%
2,4-dichloro-6-... CAS#:5419-53-4 |
| Literature: I.G. Farbenind. Patent: DE539182 , 1929 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 18, p. 2577 |
|
~%
2,4-dichloro-6-... CAS#:5419-53-4 |
| Literature: Finn et al. Journal of Applied Chemistry, 1954 , vol. 4, p. 497,502 |
| (5-Chlor-2-hydroxy-phenyl)-(3.5-dichlor-2-hydroxy-phenyl)-methan |
| 4,6,4'-trichloro-2,2'-methanediyl-di-phenol |
| 4,6,4'-Trichlor-2,2'-methandiyl-di-phenol |
| 2,4-dichloro-6-(5-chloro-2-hydroxybenzyl)phenol |