2'',5-DICHLOOR-2-(3-METHYL-4H-1,2,4-TRIAZOOL-4-YL)BENZOFENON structure
|
Common Name | 2'',5-DICHLOOR-2-(3-METHYL-4H-1,2,4-TRIAZOOL-4-YL)BENZOFENON | ||
|---|---|---|---|---|
| CAS Number | 54196-61-1 | Molecular Weight | 332.18400 | |
| Density | 1.38g/cm3 | Boiling Point | 555.5ºC at 760 mmHg | |
| Molecular Formula | C16H11Cl2N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.8ºC | |
| Name | [5-chloro-2-(3-methyl-1,2,4-triazol-4-yl)phenyl]-(2-chlorophenyl)methanone |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 555.5ºC at 760 mmHg |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.18400 |
| Flash Point | 289.8ºC |
| Exact Mass | 331.02800 |
| PSA | 47.78000 |
| LogP | 4.11350 |
| Index of Refraction | 1.66 |
| InChIKey | MPEDDLDWEDSQOT-UHFFFAOYSA-N |
| SMILES | Cc1nncn1-c1ccc(Cl)cc1C(=O)c1ccccc1Cl |
| HS Code | 2933990090 |
|---|
|
~57%
2'',5-DICHLOOR-... CAS#:54196-61-1 |
| Literature: Hester Jr. Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 3 p. 575 - 581 |
|
~%
2'',5-DICHLOOR-... CAS#:54196-61-1 |
| Literature: Hester Jr. Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 3 p. 575 - 581 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |