1-phenyl-2-(4-propoxyphenoxy)ethanone structure
|
Common Name | 1-phenyl-2-(4-propoxyphenoxy)ethanone | ||
|---|---|---|---|---|
| CAS Number | 5420-57-5 | Molecular Weight | 270.32300 | |
| Density | 1.097g/cm3 | Boiling Point | 425.2ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.8ºC | |
| Name | 1-phenyl-2-(4-propoxyphenoxy)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 425.2ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 202.8ºC |
| Exact Mass | 270.12600 |
| PSA | 35.53000 |
| LogP | 3.73710 |
| Index of Refraction | 1.549 |
| InChIKey | WDGAPNPHHJGVRF-UHFFFAOYSA-N |
| SMILES | CCCOc1ccc(OCC(=O)c2ccccc2)cc1 |
|
~%
1-phenyl-2-(4-p... CAS#:5420-57-5 |
| Literature: Wright; Lincoln Journal of the American Chemical Society, 1952 , vol. 74, p. 6301 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Phenyl-2-(4-propoxy-phenoxy)-aethanon |
| 1-phenyl-2-(4-propoxy-phenoxy)-ethanone |