Propanoic acid,2-[[(octyloxy)carbonyl]oxy]-, butyl ester structure
|
Common Name | Propanoic acid,2-[[(octyloxy)carbonyl]oxy]-, butyl ester | ||
|---|---|---|---|---|
| CAS Number | 5420-72-4 | Molecular Weight | 302.40600 | |
| Density | 0.987g/cm3 | Boiling Point | 361.5ºC at 760 mmHg | |
| Molecular Formula | C16H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.9ºC | |
| Name | 3-Methyl-2-oxa-bernsteinsaeure-4-butylester-1-octylester |
|---|---|
| Synonym | More Synonyms |
| Density | 0.987g/cm3 |
|---|---|
| Boiling Point | 361.5ºC at 760 mmHg |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.40600 |
| Flash Point | 152.9ºC |
| Exact Mass | 302.20900 |
| PSA | 61.83000 |
| LogP | 4.23190 |
| Index of Refraction | 1.444 |
| InChIKey | KESYLYOVDLLVCB-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC(=O)OC(C)C(=O)OCCCC |
| HS Code | 2918990090 |
|---|
|
~%
Propanoic acid,... CAS#:5420-72-4 |
| Literature: Rehberg; Dixon Journal of Organic Chemistry, 1950 , vol. 15, p. 565,571 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-octyloxycarbonyloxy-propionic acid butyl ester |
| 2-Octyloxycarbonyloxy-propionsaeure-butylester |