Benzeneacetic acid, 1,3-dimethylbutyl ester
Modify Date: 2025-09-02 13:21:52
Benzeneacetic acid, 1,3-dimethylbutyl ester structure
|
Common Name | Benzeneacetic acid, 1,3-dimethylbutyl ester | ||
|---|---|---|---|---|
| CAS Number | 5421-18-1 | Molecular Weight | 220.30700 | |
| Density | 0.976g/cm3 | Boiling Point | 287.2ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.6ºC | |
| Name | 4-methylpentan-2-yl 2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.976g/cm3 |
|---|---|
| Boiling Point | 287.2ºC at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 101.6ºC |
| Exact Mass | 220.14600 |
| PSA | 26.30000 |
| LogP | 3.20690 |
| Index of Refraction | 1.49 |
| InChIKey | POXZFBWKHWBHAR-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)OC(=O)Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
Benzeneacetic a... CAS#:5421-18-1 |
| Literature: Funcke et al. Arzneimittel Forschung, 1954 , vol. 4, p. 492 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-methylpentan-2-yl phenylacetate |
| phenyl-acetic acid-(1,3-dimethyl-butyl ester) |
| Phenyl-essigsaeure-(1,3-dimethyl-butylester) |