N-(2-benzo[1,3]dioxol-5-ylethyl)-3,4,5-trimethoxy-benzamide structure
|
Common Name | N-(2-benzo[1,3]dioxol-5-ylethyl)-3,4,5-trimethoxy-benzamide | ||
|---|---|---|---|---|
| CAS Number | 5422-05-9 | Molecular Weight | 359.37300 | |
| Density | 1.238g/cm3 | Boiling Point | 487.3ºC at 760 mmHg | |
| Molecular Formula | C19H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.5ºC | |
| Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 487.3ºC at 760 mmHg |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.37300 |
| Flash Point | 248.5ºC |
| Exact Mass | 359.13700 |
| PSA | 75.25000 |
| LogP | 2.80450 |
| Index of Refraction | 1.569 |
| InChIKey | PQMJHFPUNWZSLZ-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NCCc2ccc3c(c2)OCO3)cc(OC)c1OC |
| HS Code | 2932999099 |
|---|
|
~%
N-(2-benzo[1,3]... CAS#:5422-05-9 |
| Literature: Reeve; Eareckson Journal of the American Chemical Society, 1950 , vol. 72, p. 5195 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4,5-Trimethoxy-benzoesaeure-homopiperonylamid |
| HMS3078O11 |
| 3,4,5-trimethoxy-benzoic acid homopiperonylamide |