Benzenepropanenitrile, a-(4-chlorophenyl)-4-methoxy- structure
|
Common Name | Benzenepropanenitrile, a-(4-chlorophenyl)-4-methoxy- | ||
|---|---|---|---|---|
| CAS Number | 5422-48-0 | Molecular Weight | 271.74100 | |
| Density | 1.183g/cm3 | Boiling Point | 402.5ºC at 760 mmHg | |
| Molecular Formula | C16H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.2ºC | |
| Name | 2-(4-chlorophenyl)-3-(4-methoxyphenyl)propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 402.5ºC at 760 mmHg |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.74100 |
| Flash Point | 197.2ºC |
| Exact Mass | 271.07600 |
| PSA | 33.02000 |
| LogP | 4.19848 |
| Index of Refraction | 1.58 |
| InChIKey | AILTUCAOQVQFQZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(C#N)c2ccc(Cl)cc2)cc1 |
|
~88%
Benzenepropanen... CAS#:5422-48-0 |
| Literature: Kulp, Stuart S.; Caldwell, Craig B. Journal of Organic Chemistry, 1980 , vol. 45, # 1 p. 171 - 173 |
|
~%
Benzenepropanen... CAS#:5422-48-0 |
| Literature: Kulp, Stuart S.; Caldwell, Craig B. Journal of Organic Chemistry, 1980 , vol. 45, # 1 p. 171 - 173 |
|
~%
Benzenepropanen... CAS#:5422-48-0 |
| Literature: Kulp, Stuart S.; Caldwell, Craig B. Journal of Organic Chemistry, 1980 , vol. 45, # 1 p. 171 - 173 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(4-Chlor-phenyl)-3-(4-methoxy-phenyl)-propionitril |
| 2-(4-chloro-phenyl)-3-(4-methoxy-phenyl)-propionitrile |
| Benzenepropanenitrile,a-(4-chlorophenyl)-4-methoxy |