3-pyrrolidin-1-ylpropyl 2,6-dimethyl-4-propoxy-benzoate structure
|
Common Name | 3-pyrrolidin-1-ylpropyl 2,6-dimethyl-4-propoxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 5422-84-4 | Molecular Weight | 355.89900 | |
| Density | 1.044g/cm3 | Boiling Point | 445.5ºC at 760 mmHg | |
| Molecular Formula | C19H30ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.2ºC | |
| Name | 3-pyrrolidin-1-ylpropyl 2,6-dimethyl-4-propoxybenzoate,hydrochloride |
|---|
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 445.5ºC at 760 mmHg |
| Molecular Formula | C19H30ClNO3 |
| Molecular Weight | 355.89900 |
| Flash Point | 223.2ºC |
| Exact Mass | 355.19100 |
| PSA | 38.77000 |
| LogP | 4.47480 |
| Index of Refraction | 1.519 |
| InChIKey | UYRKAQKKJUYKQN-UHFFFAOYSA-N |
| SMILES | CCCOc1cc(C)c(C(=O)OCCCN2CCCC2)c(C)c1.Cl |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |