2,5-Diphenylhydroquinone structure
|
Common Name | 2,5-Diphenylhydroquinone | ||
|---|---|---|---|---|
| CAS Number | 5422-91-3 | Molecular Weight | 262.30300 | |
| Density | 1.209g/cm3 | Boiling Point | 486.3ºC at 760 mmHg | |
| Molecular Formula | C18H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.1ºC | |
| Name | 2,5-diphenylbenzene-1,4-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 486.3ºC at 760 mmHg |
| Molecular Formula | C18H14O2 |
| Molecular Weight | 262.30300 |
| Flash Point | 235.1ºC |
| Exact Mass | 262.09900 |
| PSA | 40.46000 |
| LogP | 4.43180 |
| Index of Refraction | 1.651 |
| InChIKey | BVVCBZSERKSMIE-UHFFFAOYSA-N |
| SMILES | Oc1cc(-c2ccccc2)c(O)cc1-c1ccccc1 |
| HS Code | 2906299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 3 | |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Induction of amyloid beta (25 to 35) disaggregation after 4 days by Thioflavin-T fluo...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1763695
|
|
Name: Inhibition of amyloid beta (25 to 35) aggregation for 4 days by Thioflavin-T fluoresc...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1763694
|
|
Name: Cytotoxicity against human SH-SY5Y cells up to 20 uM for 24 hrs by MTT assay
Source: ChEMBL
Target: SH-SY5Y
External Id: CHEMBL1763697
|
|
Name: Inhibition of human recombinant BACE1 preincubated after 1 hr by fluorescence assay
Source: ChEMBL
Target: Beta-secretase 1
External Id: CHEMBL1763696
|
| (1,1',4',1'')-terpheny-2,5-diol |
| 2,5-Diphenylhydroquinone |
| Hydroquinone,5-diphenyl |
| 2,5-diphenyl-1,4-dihydroquinone |
| 2,5-diphenyl-1,4-dihydroxybenzene |
| 2',5'-dihydroxy-p-terphenyl |
| p-Terphenyl-2',5'-diol |
| [1,1':4',1''-Terphenyl]-2',5'-diol |