1,3-Benzodioxol-5-yl(phenyl)methanone structure
|
Common Name | 1,3-Benzodioxol-5-yl(phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 54225-86-4 | Molecular Weight | 226.22700 | |
| Density | 1.265g/cm3 | Boiling Point | 377.7ºC at 760 mmHg | |
| Molecular Formula | C14H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 1,3-Benzodioxol-5-yl(phenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 377.7ºC at 760 mmHg |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.22700 |
| Flash Point | 173.7ºC |
| Exact Mass | 226.06300 |
| PSA | 35.53000 |
| LogP | 2.64630 |
| Index of Refraction | 1.612 |
| InChIKey | PXAFOQOPSOGIFE-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc2c(c1)OCO2 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-benzodioxol-5-yl(phenyl)methanone |