butyl 3-(2-butoxycarbonylethylsulfonyl)propanoate structure
|
Common Name | butyl 3-(2-butoxycarbonylethylsulfonyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 5423-27-8 | Molecular Weight | 322.41800 | |
| Density | 1.12g/cm3 | Boiling Point | 463.4ºC at 760 mmHg | |
| Molecular Formula | C14H26O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.1ºC | |
| Name | butyl 3-(3-butoxy-3-oxopropyl)sulfonylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 463.4ºC at 760 mmHg |
| Molecular Formula | C14H26O6S |
| Molecular Weight | 322.41800 |
| Flash Point | 234.1ºC |
| Exact Mass | 322.14500 |
| PSA | 95.12000 |
| LogP | 2.94880 |
| Index of Refraction | 1.464 |
| InChIKey | VUUQFLLRJFDANW-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)CCS(=O)(=O)CCC(=O)OCCCC |
| HS Code | 2915900090 |
|---|
|
~%
butyl 3-(2-buto... CAS#:5423-27-8 |
| Literature: Kerber,R.; Starnick,J. Chemische Berichte, 1971 , vol. 104, p. 2035 - 2043 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| dibutyl 3,3'-sulfonyldipropanoate |
| Bis-<2-butyloxycarbonyl-aethyl>-sulfon |
| 3,3'-sulfonyldi-propionic acid,dibutyl ester |