N-(3-(aminomethyl)-7-chloro-4-quinolinyl)-N-butylamine structure
|
Common Name | N-(3-(aminomethyl)-7-chloro-4-quinolinyl)-N-butylamine | ||
|---|---|---|---|---|
| CAS Number | 5423-72-3 | Molecular Weight | 263.76600 | |
| Density | 1.211g/cm3 | Boiling Point | 433.8ºC at 760 mmHg | |
| Molecular Formula | C14H18ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 3-(aminomethyl)-N-butyl-7-chloroquinolin-4-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.211g/cm3 |
|---|---|
| Boiling Point | 433.8ºC at 760 mmHg |
| Molecular Formula | C14H18ClN3 |
| Molecular Weight | 263.76600 |
| Flash Point | 216.2ºC |
| Exact Mass | 263.11900 |
| PSA | 50.94000 |
| LogP | 4.33220 |
| Index of Refraction | 1.646 |
| InChIKey | LKEMVVCLTDWQJE-UHFFFAOYSA-N |
| SMILES | CCCCNc1c(CN)cnc2cc(Cl)ccc12 |
|
~%
N-(3-(aminometh... CAS#:5423-72-3 |
| Literature: Price; Boekelheide Journal of the American Chemical Society, 1946 , vol. 68, p. 1246,1249 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (3-aminomethyl-7-chloro-[4]quinolyl)-butyl-amine |
| N-(3-(aminomethyl)-7-chloro-4-quinolinyl)-N-butylamine |
| (3-Aminomethyl-7-chlor-[4]chinolyl)-butyl-amin |
| 3-quinolinemethanamine,4-(butylamino)-7-chloro |