4-(5-chloro-2-methylsulfanyl-benzoimidazol-1-yl)-N,N-diethyl-pentan-1-amine
Modify Date: 2025-11-25 10:54:07
4-(5-chloro-2-methylsulfanyl-benzoimidazol-1-yl)-N,N-diethyl-pentan-1-amine structure
|
Common Name | 4-(5-chloro-2-methylsulfanyl-benzoimidazol-1-yl)-N,N-diethyl-pentan-1-amine | ||
|---|---|---|---|---|
| CAS Number | 5423-92-7 | Molecular Weight | 339.92600 | |
| Density | 1.14g/cm3 | Boiling Point | 462.1ºC at 760 mmHg | |
| Molecular Formula | C17H26ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.3ºC | |
| Name | diethyl-[3-(5-bromo-furan-2-carbonyloxy)-butyl]-methyl-ammonium,iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 462.1ºC at 760 mmHg |
| Molecular Formula | C17H26ClN3S |
| Molecular Weight | 339.92600 |
| Flash Point | 233.3ºC |
| Exact Mass | 339.15400 |
| PSA | 46.36000 |
| LogP | 5.09460 |
| Index of Refraction | 1.579 |
| InChIKey | WDXHMHWOXHKXEF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCC(C)n1c(SC)nc2cc(Cl)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diaethyl-[4-(5-chlor-2-methylmercapto-benzimidazol-1-yl)-pentyl]-amin |
| diethyl-[4-(5-chloro-2-methylsulfanyl-benzimidazol-1-yl)-pentyl]-amine |
| Diaethyl-[3-(5-brom-furan-2-carbonyloxy)-butyl]-methyl-ammonium,Jodid |