Hydrazinecarbothioamide, 2-[1-(4-nitrophenyl)ethylidene]- structure
|
Common Name | Hydrazinecarbothioamide, 2-[1-(4-nitrophenyl)ethylidene]- | ||
|---|---|---|---|---|
| CAS Number | 5424-45-3 | Molecular Weight | 238.26600 | |
| Density | 1.41g/cm3 | Boiling Point | 406.6ºC at 760mmHg | |
| Molecular Formula | C9H10N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.7ºC | |
| Name | [1-(4-nitrophenyl)ethylideneamino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 406.6ºC at 760mmHg |
| Molecular Formula | C9H10N4O2S |
| Molecular Weight | 238.26600 |
| Flash Point | 199.7ºC |
| Exact Mass | 238.05200 |
| PSA | 128.32000 |
| LogP | 2.76640 |
| Index of Refraction | 1.661 |
| InChIKey | LLXZVONSOWGFJC-WDZFZDKYSA-N |
| SMILES | CC(=NNC(N)=S)c1ccc([N+](=O)[O-])cc1 |
|
~94%
Hydrazinecarbot... CAS#:5424-45-3 |
| Literature: Hosny, Mona A.; El-Sayed, Taghreed H.; El-Sawi, Emtithal A. E-Journal of Chemistry, 2012 , vol. 9, # 3 p. 1276 - 1287 |
|
~%
Hydrazinecarbot... CAS#:5424-45-3 |
| Literature: Miyatake Yakugaku Zasshi, 1953 , vol. 73, p. 460,462 Chem.Abstr., 1954 , p. 5145 |
|
~%
Hydrazinecarbot... CAS#:5424-45-3 |
| Literature: Miyatake Yakugaku Zasshi, 1953 , vol. 73, p. 460,462 Chem.Abstr., 1954 , p. 5145 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4'-nitroacetophenone thiosemicarbazone |
| p-acetylnitrobenzene |
| p-nitroacetophenone thiosemicarbazone |
| 1-(4-Nitro-phenyl)-aethanon-thiosemicarbazon |
| Ethanone,1-(4-nitrophenyl) |
| (pNO2-C6H4)C(CH3)NNHCSNH2 |
| 1-(4-nitro-phenyl)-ethanone thiosemicarbazone |
| 1-(4-nitrophenyl)ethan-1-one |