1-Propanone,3-(dimethylamino)-1-(4-nitrophenyl)-, hydrobromide (1:1) structure
|
Common Name | 1-Propanone,3-(dimethylamino)-1-(4-nitrophenyl)-, hydrobromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5424-48-6 | Molecular Weight | 303.15200 | |
| Density | 1.172g/cm3 | Boiling Point | 343.2ºC at 760mmHg | |
| Molecular Formula | C11H15BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4ºC | |
| Name | 3-(dimethylamino)-1-(4-nitrophenyl)propan-1-one hydrobromide |
|---|
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 343.2ºC at 760mmHg |
| Molecular Formula | C11H15BrN2O3 |
| Molecular Weight | 303.15200 |
| Flash Point | 161.4ºC |
| Exact Mass | 302.02700 |
| PSA | 66.13000 |
| LogP | 3.21050 |
| InChIKey | RRVBUILZPLPEAJ-UHFFFAOYSA-N |
| SMILES | Br.CN(C)CCC(=O)c1ccc([N+](=O)[O-])cc1 |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |