ethyl 2-acetamido-2-cyano-5-oxo-pentanoate structure
|
Common Name | ethyl 2-acetamido-2-cyano-5-oxo-pentanoate | ||
|---|---|---|---|---|
| CAS Number | 5424-83-9 | Molecular Weight | 226.22900 | |
| Density | 1.167g/cm3 | Boiling Point | 452.3ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.3ºC | |
| Name | ethyl 2-acetamido-2-cyano-5-oxopentanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 452.3ºC at 760 mmHg |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.22900 |
| Flash Point | 227.3ºC |
| Exact Mass | 226.09500 |
| PSA | 96.26000 |
| LogP | 0.31798 |
| Index of Refraction | 1.467 |
| InChIKey | YBINZPGMDSQTBF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)(CCC=O)NC(C)=O |
| HS Code | 2926909090 |
|---|
|
~%
ethyl 2-acetami... CAS#:5424-83-9 |
| Literature: Moe; Warner Journal of the American Chemical Society, 1948 , vol. 70, p. 2763 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Acetylamino-2-cyan-5-oxo-valeriansaeure-aethylester |
| ethyl n-acetyl-2-cyano-5-oxonorvalinate |
| 4-Acetamino-4-carbaethoxy-4-cyan-butyraldehyd |
| 2-acetylamino-2-cyano-5-oxo-valeric acid ethyl ester |