1-Penten-3-one,1-(2,3-dimethoxyphenyl)-5-(4-morpholinyl)-, hydrochloride (1:1) structure
|
Common Name | 1-Penten-3-one,1-(2,3-dimethoxyphenyl)-5-(4-morpholinyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 5424-87-3 | Molecular Weight | 341.83000 | |
| Density | 1.118g/cm3 | Boiling Point | 459.5ºC at 760 mmHg | |
| Molecular Formula | C17H24ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.7ºC | |
| Name | (Z)-1-(2,3-dimethoxyphenyl)-5-morpholin-4-ylpent-1-en-3-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.118g/cm3 |
|---|---|
| Boiling Point | 459.5ºC at 760 mmHg |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.83000 |
| Flash Point | 231.7ºC |
| Exact Mass | 341.13900 |
| PSA | 48.00000 |
| LogP | 2.74830 |
| Index of Refraction | 1.545 |
| InChIKey | ZMGSZZQVEWZSKM-NAFXZHHSSA-N |
| SMILES | COc1cccc(C=CC(=O)CCN2CCOCC2)c1OC.Cl |
|
~%
1-Penten-3-one,... CAS#:5424-87-3 |
| Literature: Burckhalter; Johnson Journal of the American Chemical Society, 1951 , vol. 73, p. 4835 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-benzo[1,3]dioxol-5-yl-4-methyl-pent-1-en-3-one |
| 1-Penten-3-one,4-methyl-1-(3,4-methylenedioxyphenyl) |
| 1-Penten-3-one,1-(1,3-benzodioxol-5-yl)-4-methyl |
| 1t-(2,3-Dimethoxy-phenyl)-5-morpholino-pent-1-en-3-on,Hydrochlorid |
| 4-Methyl-1-(3,4-methylenedioxyphenyl)-1-penten-3-one |
| 1t-(2,3-dimethoxy-phenyl)-5-morpholino-pent-1-en-3-one,hydrochloride |
| 1-(Benzo-1,3-dioxol-5-yl)-4-methyl-pent-1-en-3-on |