1-chloro-4-[(4-chlorophenyl)methylsulfanylmethylsulfanylmethyl]benzene structure
|
Common Name | 1-chloro-4-[(4-chlorophenyl)methylsulfanylmethylsulfanylmethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 5424-92-0 | Molecular Weight | 329.30800 | |
| Density | 1.31g/cm3 | Boiling Point | 438.6ºC at 760 mmHg | |
| Molecular Formula | C15H14Cl2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 1-chloro-4-[(4-chlorophenyl)methylsulfanylmethylsulfanylmethyl]benzene |
|---|
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 438.6ºC at 760 mmHg |
| Molecular Formula | C15H14Cl2S2 |
| Molecular Weight | 329.30800 |
| Flash Point | 201.7ºC |
| Exact Mass | 327.99100 |
| PSA | 50.60000 |
| LogP | 6.11750 |
| Index of Refraction | 1.641 |
| InChIKey | ONOXSXZOHHQXFK-UHFFFAOYSA-N |
| SMILES | Clc1ccc(CSCSCc2ccc(Cl)cc2)cc1 |
|
~%
1-chloro-4-[(4-... CAS#:5424-92-0 |
| Literature: Kulka; Van Stryk Canadian Journal of Chemistry, 1957 , vol. 35, p. 519,521 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |