N-(3-arsorosophenyl)acetamide structure
|
Common Name | N-(3-arsorosophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 5425-06-9 | Molecular Weight | 225.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H8AsNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-arsorosophenyl)acetamide |
|---|
| Molecular Formula | C8H8AsNO2 |
|---|---|
| Molecular Weight | 225.08 |
| Exact Mass | 224.977098 |
| PSA | 46.17000 |
| LogP | 0.50550 |
| InChIKey | UVZWDCGRWHRZKR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC(=CC=C1)[As]=O |
|
~%
N-(3-arsorosoph... CAS#:5425-06-9 |
| Literature: Doak; Eagle; Steinman Journal of the American Chemical Society, 1940 , vol. 62, p. 3010 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |