[(4-arsenoso-phenyl)-acetyl]-urea
Modify Date: 2025-08-31 11:49:03
![[(4-arsenoso-phenyl)-acetyl]-urea Structure](https://image.chemsrc.com/caspic/274/5425-17-2.png)
[(4-arsenoso-phenyl)-acetyl]-urea structure
|
Common Name | [(4-arsenoso-phenyl)-acetyl]-urea | ||
|---|---|---|---|---|
| CAS Number | 5425-17-2 | Molecular Weight | 269.10900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10AsN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(4-arsenoso-phenyl)-acetyl]-urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10AsN2O3 |
|---|---|
| Molecular Weight | 269.10900 |
| Exact Mass | 268.99100 |
| PSA | 89.26000 |
| LogP | 0.30270 |
| InChIKey | DUDUDQPSJZJVFI-UHFFFAOYSA-N |
| SMILES | NC(=O)NC(=O)Cc1ccc([As]=O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
[(4-arsenoso-ph... CAS#:5425-17-2 |
| Literature: Steinman; Doak; Eagle Journal of the American Chemical Society, 1944 , vol. 66, p. 192 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| [(4-Arsenoso-phenyl)-acetyl]-harnstoff |
| 2-(4-arsenosophenyl)-N-carbamoyl-acetamide |