N-(4-arsenoso-[1]naphthyl)-acetamide structure
|
Common Name | N-(4-arsenoso-[1]naphthyl)-acetamide | ||
|---|---|---|---|---|
| CAS Number | 5425-32-1 | Molecular Weight | 276.14300 | |
| Density | 1.258g/cm3 | Boiling Point | 478.8ºC at 760 mmHg | |
| Molecular Formula | C12H11AsNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1ºC | |
| Name | N-(4-arsenoso-[1]naphthyl)-acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 478.8ºC at 760 mmHg |
| Molecular Formula | C12H11AsNO2 |
| Molecular Weight | 276.14300 |
| Flash Point | 139.1ºC |
| Exact Mass | 276.00100 |
| PSA | 46.17000 |
| LogP | 1.65870 |
| Index of Refraction | 1.764 |
| InChIKey | GFHOUFDUDKLWAG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc([As]=O)c2ccccc12 |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-arsenoso-[... CAS#:5425-32-1 |
| Literature: Doak; Eagle; Steinman Journal of the American Chemical Society, 1942 , vol. 64, p. 1064 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-{4-[(2S)-2-chloropropanoyl]phenyl}acetamide |
| 1-(4-acetylaminophenyl)-2-chloropropanone |
| 1-(4-acetylaminophenyl)-2-chloro-1-propanone |
| N-[4-(2-chloropropionyl)phenyl]acetamide |
| N-[4-(2-chloro-1-oxopropyl)phenyl]acetamide |
| 4-Acetamino-1-arsenoso-naphthalin |