Methyl 4-octylbenzoate structure
|
Common Name | Methyl 4-octylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 54256-51-8 | Molecular Weight | 248.361 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 340.9±21.0 °C at 760 mmHg | |
| Molecular Formula | C16H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.7±8.5 °C | |
| Name | 4-octyl-Benzoic acid, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.9±21.0 °C at 760 mmHg |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.361 |
| Flash Point | 152.7±8.5 °C |
| Exact Mass | 248.177628 |
| PSA | 26.30000 |
| LogP | 6.38 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | NKSKNAWLKUQLNY-UHFFFAOYSA-N |
| SMILES | CCCCCCCCc1ccc(C(=O)OC)cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-octyl-, methyl ester |
| Methyl p-octylbenzoate |
| 4-Octylbenzoicacidmethylester |
| Methyl 4-octylbenzoate |