2-(2-methylpropanoyl)indene-1,3-dione structure
|
Common Name | 2-(2-methylpropanoyl)indene-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 5426-11-9 | Molecular Weight | 216.23300 | |
| Density | 1.227g/cm3 | Boiling Point | 381.8ºC at 760 mmHg | |
| Molecular Formula | C13H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | 2-(2-methylpropanoyl)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 381.8ºC at 760 mmHg |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.23300 |
| Flash Point | 165.7ºC |
| Exact Mass | 216.07900 |
| PSA | 51.21000 |
| LogP | 1.90690 |
| Index of Refraction | 1.561 |
| InChIKey | GWZHPSHQKPBGNN-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1C(=O)c2ccccc2C1=O |
| HS Code | 2914399090 |
|---|
|
~%
2-(2-methylprop... CAS#:5426-11-9 |
| Literature: Kilgore; Ford; Wolfe Industrial and Engineering Chemistry, 1942 , vol. 34, p. 494,496 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 2-(2-methylpropanoyl)-1h-indene-1,3(2h)-dione |
| 2-isobutyryl-1,3-indandione |
| 2-isobutyryl-indan-1,3-dione |
| 2-Isobutyryl-indan-1,3-dion |