Decanediamide,N1,N1,N10,N10-tetracyclohexyl- structure
|
Common Name | Decanediamide,N1,N1,N10,N10-tetracyclohexyl- | ||
|---|---|---|---|---|
| CAS Number | 5426-13-1 | Molecular Weight | 528.85200 | |
| Density | 1.02g/cm3 | Boiling Point | 670.5ºC at 760mmHg | |
| Molecular Formula | C34H60N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
| Name | N,N,N',N'-tetracyclohexyldecanediamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 670.5ºC at 760mmHg |
| Molecular Formula | C34H60N2O2 |
| Molecular Weight | 528.85200 |
| Flash Point | 248.9ºC |
| Exact Mass | 528.46500 |
| PSA | 40.62000 |
| LogP | 9.09520 |
| Index of Refraction | 1.527 |
| InChIKey | UTVYLEGWWLNNLV-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCCC(=O)N(C1CCCCC1)C1CCCCC1)N(C1CCCCC1)C1CCCCC1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Sebacoyl biscyclohexylamide |