2-(dimethylaminomethyl)-6-methoxy-4-tert-butyl-phenol
Modify Date: 2025-08-25 17:21:07
2-(dimethylaminomethyl)-6-methoxy-4-tert-butyl-phenol structure
|
Common Name | 2-(dimethylaminomethyl)-6-methoxy-4-tert-butyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 5426-16-4 | Molecular Weight | 237.33800 | |
| Density | 1.009g/cm3 | Boiling Point | 308.2ºC at 760mmHg | |
| Molecular Formula | C14H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-tert-butyl-2-[(dimethylamino)methyl]-6-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.009g/cm3 |
|---|---|
| Boiling Point | 308.2ºC at 760mmHg |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.33800 |
| Exact Mass | 237.17300 |
| PSA | 32.70000 |
| LogP | 2.75990 |
| Index of Refraction | 1.516 |
| InChIKey | OIZVVWFMMXNOED-UHFFFAOYSA-N |
| SMILES | COc1cc(C(C)(C)C)cc(CN(C)C)c1O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(dimethylaminomethyl)-6-methoxy-4-tert-butyl-phenol |
| 6-Dimethylaminomethyl-4-t-butylguaiacol |