8-(aminomethyl)-1,3-dimethyl-7H-purine-2,6-dione structure
|
Common Name | 8-(aminomethyl)-1,3-dimethyl-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 5426-57-3 | Molecular Weight | 209.20500 | |
| Density | 1.464g/cm3 | Boiling Point | 503.7ºC at 760 mmHg | |
| Molecular Formula | C8H11N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5ºC | |
| Name | 8-(aminomethyl)-1,3-dimethyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.464g/cm3 |
|---|---|
| Boiling Point | 503.7ºC at 760 mmHg |
| Molecular Formula | C8H11N5O2 |
| Molecular Weight | 209.20500 |
| Flash Point | 258.5ºC |
| Exact Mass | 209.09100 |
| PSA | 98.70000 |
| Index of Refraction | 1.641 |
| InChIKey | XMLYQLPLUFLBEC-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c(CN)nc2n(C)c1=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-Aminomethyl-1,3-dimethylxanthin |
| 8-aminomethyl-1,3-dimethyl-3,7-dihydro-purine-2,6-dione |
| 8-Aminomethyl-1,3-dimethyl-3,7-dihydro-purin-2,6-dion |