3-benzo[1,3]dioxol-5-yl-3-hydroxy-2-phenyl-propanoic acid structure
|
Common Name | 3-benzo[1,3]dioxol-5-yl-3-hydroxy-2-phenyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 5426-82-4 | Molecular Weight | 286.27900 | |
| Density | 1.401g/cm3 | Boiling Point | 446.2ºC at 760mmHg | |
| Molecular Formula | C16H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.6ºC | |
| Name | 3-(1,3-benzodioxol-5-yl)-3-hydroxy-2-phenylpropanoic acid |
|---|
| Density | 1.401g/cm3 |
|---|---|
| Boiling Point | 446.2ºC at 760mmHg |
| Molecular Formula | C16H14O5 |
| Molecular Weight | 286.27900 |
| Flash Point | 166.6ºC |
| Exact Mass | 286.08400 |
| PSA | 75.99000 |
| LogP | 2.31710 |
| Index of Refraction | 1.646 |
| InChIKey | XZCYDMWCEOPIRU-UHFFFAOYSA-N |
| SMILES | O=C(O)C(c1ccccc1)C(O)c1ccc2c(c1)OCO2 |
|
~%
3-benzo[1,3]dio... CAS#:5426-82-4 |
| Literature: Alexander; Barthel Journal of Organic Chemistry, 1957 , vol. 22, p. 1647 |
|
~%
3-benzo[1,3]dio... CAS#:5426-82-4 |
| Literature: Ivanoff; Mihova; Christova Bulletin de la Societe Chimique de France, 1932 , vol. <4> 51, p. 1321,1324 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |