N,N-Dimethyl-4-[2-(2,3-dihydro-1,3,3-trimethyl-1H-indole-2-yl)ethenyl]benzenamine structure
|
Common Name | N,N-Dimethyl-4-[2-(2,3-dihydro-1,3,3-trimethyl-1H-indole-2-yl)ethenyl]benzenamine | ||
|---|---|---|---|---|
| CAS Number | 54268-71-2 | Molecular Weight | 306.44500 | |
| Density | 1.078g/cm3 | Boiling Point | 448.1ºC at 760 mmHg | |
| Molecular Formula | C21H26N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.9ºC | |
| Name | N,N-dimethyl-4-[2-(1,3,3-trimethyl-2H-indol-2-yl)ethenyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.078g/cm3 |
|---|---|
| Boiling Point | 448.1ºC at 760 mmHg |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.44500 |
| Flash Point | 201.9ºC |
| Exact Mass | 306.21000 |
| PSA | 6.48000 |
| LogP | 4.62700 |
| Index of Refraction | 1.644 |
| InChIKey | VGWSUVRKHUPJBD-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=CC2N(C)c3ccccc3C2(C)C)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(2-(2,3-Dihydro-1,3,3-trimethyl-1H-indol-2-yl)ethenyl)-N,N-dimethylbenzenamine |
| Benzenamine,4-(2-(2,3-dihydro-1,3,3-trimethyl-1H-indol-2-yl)ethenyl)-N,N-dimethyl |
| N,N-Dimethyl-4-[2-(2,3-dihydro-1,3,3-trimethyl-1H-indole-2-yl)ethenyl]benzenamine |