Phenol,4-cyclohexyl-2,6-bis(1,1-dimethylethyl)- structure
|
Common Name | Phenol,4-cyclohexyl-2,6-bis(1,1-dimethylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 5427-08-7 | Molecular Weight | 288.46700 | |
| Density | 0.953g/cm3 | Boiling Point | 344.6ºC at 760mmHg | |
| Molecular Formula | C20H32O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.3ºC | |
| Name | 2,6-ditert-butyl-4-cyclohexylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.953g/cm3 |
|---|---|
| Boiling Point | 344.6ºC at 760mmHg |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.46700 |
| Flash Point | 155.3ºC |
| Exact Mass | 288.24500 |
| PSA | 20.23000 |
| LogP | 6.03490 |
| Index of Refraction | 1.512 |
| InChIKey | CDSVIAVJONAPBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C2CCCCC2)cc(C(C)(C)C)c1O |
| HS Code | 2907199090 |
|---|
|
~%
Phenol,4-cycloh... CAS#:5427-08-7 |
| Literature: Gulf Research and Devel. Co. Patent: US2248827 , 1938 ; |
|
~%
Phenol,4-cycloh... CAS#:5427-08-7 |
| Literature: Cook; Norcross Journal of the American Chemical Society, 1959 , vol. 81, p. 1176,1178 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,6-Di-tert.-butyl-4-cyclohexyl-phenyl |
| 2-Hydroxy-1.3-di-tert.-butyl-5-cyclohexyl-benzol |
| 2,6-Di-tert-butyl-4-cyclohexyl-phenol |
| 1-Hydroxy-2,6-di-tert-butyl-4-cyclohexylbenzene |
| 2,6-Di-t-butyl-4-cyclohexylphenol |