Benzoic acid,2-hydroxy-4-(phenylmethoxy)-, methyl ester structure
|
Common Name | Benzoic acid,2-hydroxy-4-(phenylmethoxy)-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 5427-29-2 | Molecular Weight | 258.26900 | |
| Density | 1.227g/cm3 | Boiling Point | 404.8ºC at 760 mmHg | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | methyl 2-hydroxy-4-phenylmethoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760 mmHg |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.26900 |
| Flash Point | 150.7ºC |
| Exact Mass | 258.08900 |
| PSA | 55.76000 |
| LogP | 2.75780 |
| Index of Refraction | 1.59 |
| InChIKey | PHYPTZODBQEMJU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(OCc2ccccc2)cc1O |
| HS Code | 2918990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 2-hydroxy-4-benzyloxybenzoate |
| methyl 4-benzyloxy-2-hydroxybenzoate |
| METHYL 2-HYDROXY-4-PHENYLMETHOXY-BENZOATE |
| 4-benzyloxy-2-hydroxybenzoic acid methyl ester |
| 4-Benzyloxy-2-hydroxy-benzoesaeure-methylester |