1,3-Propanediamine,N3-(7-chloro-1-isoquinolinyl)-N1,N1-diethyl-, hydrochloride (1:2) structure
|
Common Name | 1,3-Propanediamine,N3-(7-chloro-1-isoquinolinyl)-N1,N1-diethyl-, hydrochloride (1:2) | ||
|---|---|---|---|---|
| CAS Number | 5427-64-5 | Molecular Weight | 328.28000 | |
| Density | 1.3g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H23Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N1-(7-chloroisoquinolin-1-yl)-N3,N3-diethylpropane-1,3-diamine hydrochloride |
|---|
| Density | 1.3g/cm3 |
|---|---|
| Molecular Formula | C16H23Cl2N3 |
| Molecular Weight | 328.28000 |
| Exact Mass | 327.12700 |
| PSA | 28.16000 |
| LogP | 4.90700 |
| Index of Refraction | 1.666 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |