Acetic acid,2-(4-nitrophenoxy)-, 2-(ethylphenylamino)ethyl ester structure
|
Common Name | Acetic acid,2-(4-nitrophenoxy)-, 2-(ethylphenylamino)ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5427-94-1 | Molecular Weight | 344.36200 | |
| Density | 1.242g/cm3 | Boiling Point | 502.7ºC at 760mmHg | |
| Molecular Formula | C18H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.8ºC | |
| Name | 2-(N-ethylanilino)ethyl 2-(4-nitrophenoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 502.7ºC at 760mmHg |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.36200 |
| Flash Point | 257.8ºC |
| Exact Mass | 344.13700 |
| PSA | 84.59000 |
| LogP | 3.56650 |
| Index of Refraction | 1.591 |
| InChIKey | NXKMIQPTQLJINU-UHFFFAOYSA-N |
| SMILES | CCN(CCOC(=O)COc1ccc([N+](=O)[O-])cc1)c1ccccc1 |
|
~%
Acetic acid,2-(... CAS#:5427-94-1 |
| Literature: Boucher; Campaigne Proceedings of the Indiana Academy of Science, 1949 , vol. 58, p. 128,130 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Diethylamino ethylamide de l'acide p-nitrophenoxyacetique chlorhydrate |