5,8-dimethoxy-4-oxo-1H-quinoline-2-carboxylic acid structure
|
Common Name | 5,8-dimethoxy-4-oxo-1H-quinoline-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 5428-14-8 | Molecular Weight | 249.21900 | |
| Density | 1.381g/cm3 | Boiling Point | 461.1ºC at 760 mmHg | |
| Molecular Formula | C12H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.6ºC | |
| Name | 4-hydroxy-5,8-dimethoxy-quinoline-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381g/cm3 |
|---|---|
| Boiling Point | 461.1ºC at 760 mmHg |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.21900 |
| Flash Point | 232.6ºC |
| Exact Mass | 249.06400 |
| PSA | 88.88000 |
| LogP | 1.65580 |
| Index of Refraction | 1.591 |
| InChIKey | XSOWVTSDTRMVPW-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c2c(=O)cc(C(=O)O)[nH]c12 |
| HS Code | 2933499090 |
|---|
|
~%
5,8-dimethoxy-4... CAS#:5428-14-8 |
| Literature: Kaslow; Young Journal of the American Chemical Society, 1950 , vol. 72, p. 5325 |
|
~%
5,8-dimethoxy-4... CAS#:5428-14-8 |
| Literature: Kaslow; Young Journal of the American Chemical Society, 1950 , vol. 72, p. 5325 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Hydroxy-5,8-dimethoxy-chinolin-2-carbonsaeure |