ethyl 4-oxo-6-phenyl-1H-quinoline-2-carboxylate
Modify Date: 2025-08-21 19:21:32
ethyl 4-oxo-6-phenyl-1H-quinoline-2-carboxylate structure
|
Common Name | ethyl 4-oxo-6-phenyl-1H-quinoline-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5428-31-9 | Molecular Weight | 293.31700 | |
| Density | 1.224g/cm3 | Boiling Point | 464.3ºC at 760 mmHg | |
| Molecular Formula | C18H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.6ºC | |
| Name | 4-hydroxy-6-phenyl-quinoline-2-carboxylic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 464.3ºC at 760 mmHg |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.31700 |
| Flash Point | 234.6ºC |
| Exact Mass | 293.10500 |
| PSA | 59.42000 |
| LogP | 3.78410 |
| Index of Refraction | 1.597 |
| InChIKey | CIKFPAYTONMDRZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(=O)c2cc(-c3ccccc3)ccc2[nH]1 |
| HS Code | 2933499090 |
|---|
|
~%
ethyl 4-oxo-6-p... CAS#:5428-31-9 |
| Literature: Kaslow; Hayek Journal of the American Chemical Society, 1951 , vol. 73, p. 4986 |
![((3aR,4R,6R,6aR)-6-(4-benzamido-2-oxopyrimidin-1(2H)-yl)-2,2-dimethyltetrahydrofuro[3,4-d][1,3]dioxol-4-yl)methyl 4-methylbenzoate structure](https://image.chemsrc.com/caspic/209/98807-33-1.png)
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Hydroxy-6-phenyl-chinolin-2-carbonsaeure-aethylester |
| 4-Hydroxy-6-phenyl-6,7-dihydro-5H-pyrrolo<3,4-d>pyrimidin |
| 6-phenyl-1,5,6,7-tetrahydro-4h-pyrrolo[3,4-d]pyrimidin-4-one |
| 6-phenyl-3,5,6,7-tetrahydro-pyrrolo[3,4-d]pyrimidin-4-one |
| 6-Phenyl-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-4-ol |