4-[(2-carbamoylsulfanylacetyl)amino]benzoic acid structure
|
Common Name | 4-[(2-carbamoylsulfanylacetyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 5429-03-8 | Molecular Weight | 254.26200 | |
| Density | 1.528g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-carbamoylsulfanylacetyl)amino]benzoic acid |
|---|
| Density | 1.528g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O4S |
| Molecular Weight | 254.26200 |
| Exact Mass | 254.03600 |
| PSA | 134.79000 |
| LogP | 1.90850 |
| Index of Refraction | 1.691 |
| InChIKey | FOLFKEUJQWZSRP-UHFFFAOYSA-N |
| SMILES | NC(=O)SCC(=O)Nc1ccc(C(=O)O)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
4-[(2-carbamoyl... CAS#:5429-03-8 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |