Benzoic acid,4-[[2-[(aminocarbonyl)thio]acetyl]amino]-, ethyl ester structure
|
Common Name | Benzoic acid,4-[[2-[(aminocarbonyl)thio]acetyl]amino]-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 5429-14-1 | Molecular Weight | 282.31600 | |
| Density | 1.356g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-Carbamoylmercapto-acetylamino)-benzoesaeure |
|---|---|
| Synonym | More Synonyms |
| Density | 1.356g/cm3 |
|---|---|
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.31600 |
| Exact Mass | 282.06700 |
| PSA | 123.79000 |
| LogP | 2.38700 |
| Index of Refraction | 1.619 |
| InChIKey | PWKQMAAHOVNGHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSC(N)=O)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
Benzoic acid,4-... CAS#:5429-14-1 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(2-carbamoylsulfanyl-acetylamino)-benzoic acid |
| 4-(2-carbamoylsulfanyl-acetylamino)-benzoic acid ethyl ester |
| 4-(C-Carbamoylmercapto-acetamino)-benzoesaeure |
| 4-(2-Carbamoylmercapto-acetylamino)-benzoesaeure-aethylester |
| 4-(C-Carbamoylmercapto-acetamino)-benzoesaeure-aethylester |
| 4-{[(carbamoylsulfanyl)acetyl]amino}benzoic acid |