N2-(6-methoxyquinolin-2-yl)-N1,N1,N3,N3-tetramethyl-propane-1,2,3-triamine structure
|
Common Name | N2-(6-methoxyquinolin-2-yl)-N1,N1,N3,N3-tetramethyl-propane-1,2,3-triamine | ||
|---|---|---|---|---|
| CAS Number | 5429-69-6 | Molecular Weight | 302.41500 | |
| Density | 1.103g/cm3 | Boiling Point | 454.8ºC at 760 mmHg | |
| Molecular Formula | C17H26N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.8ºC | |
| Name | (3S,5S,8S,9S,10S,13R,14S,16S)-3-methoxy-10,13,16-trimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-ol |
|---|
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 454.8ºC at 760 mmHg |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.41500 |
| Flash Point | 228.8ºC |
| Exact Mass | 302.21100 |
| PSA | 40.63000 |
| LogP | 2.22010 |
| Index of Refraction | 1.599 |
| InChIKey | WHDHZNZIZJZPMF-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(NC(CN(C)C)CN(C)C)ccc2c1 |
| HS Code | 2933499090 |
|---|
|
~%
N2-(6-methoxyqu... CAS#:5429-69-6 |
| Literature: Bachman; Cooper Journal of Organic Chemistry, 1944 , vol. 9, p. 302,305, 309 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |