1,3-Propanediamine,N1,N1-diethyl-N3-[4-(6-methoxy-8-quinolinyl)phenyl]- structure
|
Common Name | 1,3-Propanediamine,N1,N1-diethyl-N3-[4-(6-methoxy-8-quinolinyl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 5429-83-4 | Molecular Weight | 363.49600 | |
| Density | 1.095g/cm3 | Boiling Point | 519ºC at 760mmHg | |
| Molecular Formula | C23H29N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.7ºC | |
| Name | benzylimino-oxido-phenylazanium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.095g/cm3 |
|---|---|
| Boiling Point | 519ºC at 760mmHg |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.49600 |
| Flash Point | 267.7ºC |
| Exact Mass | 363.23100 |
| PSA | 37.39000 |
| LogP | 5.12720 |
| Index of Refraction | 1.607 |
| InChIKey | YEVNALHWCSFXNF-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCCNc1ccc(-c2cc(OC)cc3cccnc23)cc1 |
| HS Code | 2933499090 |
|---|
|
~%
1,3-Propanediam... CAS#:5429-83-4 |
| Literature: Price et al. Journal of the American Chemical Society, 1946 , vol. 68, p. 2589,2590 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-diethyl-N'-[4-(6-methoxy-[8]quinolyl)-phenyl]-propanediyldiamine |
| N,N-Diaethyl-N'-[4-(5-phenoxy-pentyloxy)-phenyl]-aethylendiamin |
| N,N-Diaethyl-N'-[4-(6-methoxy-[8]chinolyl)-phenyl]-propandiyldiamin |
| N,N-diethyl-N'-[4-(5-phenoxy-pentyloxy)-phenyl]-ethylenediamine |
| N,N-Diethyl-N'-(p-(5-phenoxypentyloxy)phenyl)ethylenediamine |
| ETHYLENEDIAMINE,N,N-DIETHYL-N'-(p-(5-PHENOXYPENTYLOXY)PHENYL) |