ethyl 5-(hydroxymethyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate structure
|
Common Name | ethyl 5-(hydroxymethyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 5430-82-0 | Molecular Weight | 197.23100 | |
| Density | 1.17g/cm3 | Boiling Point | 380ºC at 760mmHg | |
| Molecular Formula | C10H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-(hydroxymethyl)-2,4-dimethyl-1H-pyrrole-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 380ºC at 760mmHg |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23100 |
| Exact Mass | 197.10500 |
| PSA | 62.32000 |
| LogP | 1.30050 |
| Index of Refraction | 1.543 |
| InChIKey | PTSDHVPETXCHSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(C)[nH]c(CO)c1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 5-(hydrox... CAS#:5430-82-0 |
| Literature: Treibs; Zinsmeister Chemische Berichte, 1957 , vol. 90, p. 87,92 |
|
~%
ethyl 5-(hydrox... CAS#:5430-82-0 |
| Literature: Treibs; Zinsmeister Chemische Berichte, 1957 , vol. 90, p. 87,92 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-hydroxymethyl-2,4-dimethyl-pyrrole-3-carboxylic acid ethyl ester |
| 5-Hydroxymethyl-2,4-dimethyl-pyrrol-3-carbonsaeure-aethylester |
| 5-Hydroxymethyl-2,4-dimethyl-3-pyrrolcarbonsaeure-ethylester |